C15H10F2N2 — CID 103495541
5-fluoro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile (PubChem CID 103495541) has the molecular formula C15H10F2N2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-fluoro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile.
| Compound Name | 5-fluoro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 103495541 |
| Molecular Formula | C15H10F2N2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-fluoro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile |
| SMILES | N#Cc1cc(F)ccc1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C15H10F2N2/c16-12-3-4-14(11(7-12)9-18)19-6-5-10-1-2-13(17)8-15(10)19/h1-4,7-8H,5-6H2 |
| InChIKey | GZZNEGFQEZWTJK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |