C15H12FN3 — CID 103494010
3-amino-4-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile (PubChem CID 103494010) has the molecular formula C15H12FN3 and a molecular weight of 253.28 g/mol. Its IUPAC name is 3-amino-4-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile.
| Compound Name | 3-amino-4-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 103494010 |
| Molecular Formula | C15H12FN3 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-amino-4-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCc3ccc(F)cc32)c(N)c1 |
| InChI | InChI=1S/C15H12FN3/c16-12-3-2-11-5-6-19(15(11)8-12)14-4-1-10(9-17)7-13(14)18/h1-4,7-8H,5-6,18H2 |
| InChIKey | WKAUBBIOMIEHLD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|