C17H15FN2S — CID 103495528
2-ethylsulfanyl-6-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile (PubChem CID 103495528) has the molecular formula C17H15FN2S and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile.
| Compound Name | 2-ethylsulfanyl-6-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 103495528 |
| Molecular Formula | C17H15FN2S |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-ethylsulfanyl-6-(6-fluoro-2,3-dihydroindol-1-yl)benzonitrile |
| SMILES | CCSc1cccc(N2CCc3ccc(F)cc32)c1C#N |
| InChI | InChI=1S/C17H15FN2S/c1-2-21-17-5-3-4-15(14(17)11-19)20-9-8-12-6-7-13(18)10-16(12)20/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | HRVITHTVCOKTQB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |