C16H23N3S — CID 114536901
2-ethylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzonitrile (PubChem CID 114536901) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzonitrile.
| Compound Name | 2-ethylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 114536901 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-ethylsulfanyl-6-(3,4,5-trimethylpiperazin-1-yl)benzonitrile |
| SMILES | CCSc1cccc(N2CC(C)N(C)C(C)C2)c1C#N |
| InChI | InChI=1S/C16H23N3S/c1-5-20-16-8-6-7-15(14(16)9-17)19-10-12(2)18(4)13(3)11-19/h6-8,12-13H,5,10-11H2,1-4H3 |
| InChIKey | BPFAQXXIUDNVSQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |