About 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile
2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile (PubChem CID 102883409) has the molecular formula C14H18N2O2S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile |
| PubChem CID | 102883409 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile |
| SMILES | CCSc1cccc(N2CCS(=O)(=O)CC2C)c1C#N |
| InChI | InChI=1S/C14H18N2O2S2/c1-3-19-14-6-4-5-13(12(14)9-15)16-7-8-20(17,18)10-11(16)2/h4-6,11H,3,7-8,10H2,1-2H3 |
| InChIKey | VPWDXQVXTQGWFK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile?
The IUPAC name of 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile (CID 102883409) is 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile.
What is the SMILES notation for 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile?
The canonical SMILES for 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile is CCSc1cccc(N2CCS(=O)(=O)CC2C)c1C#N.
What is the InChIKey of 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile?
The InChIKey is VPWDXQVXTQGWFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S2/c1-3-19-14-6-4-5-13(12(14)9-15)16-7-8-20(17,18)10-11(16)2/h4-6,11H,3,7-8,10H2,1-2H3.
What are the key properties of 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile?
2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile has a molecular weight of 310.44 g/mol, XLogP of 2.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanyl-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzonitrile is sourced from PubChem (CID 102883409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).