C13H19N3O2S2 — CID 102883781
2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-6-methylsulfanylbenzenecarboximidamide (PubChem CID 102883781) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-6-methylsulfanylbenzenecarboximidamide.
| Compound Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-6-methylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 102883781 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-6-methylsulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(SC)cccc1N1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C13H19N3O2S2/c1-9-8-20(17,18)7-6-16(9)10-4-3-5-11(19-2)12(10)13(14)15/h3-5,9H,6-8H2,1-2H3,(H3,14,15) |
| InChIKey | QLMAALHWELNXOF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|