C11H16N4O2S — CID 102883784
6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboximidamide (PubChem CID 102883784) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is 6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboximidamide.
| Compound Name | 6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 102883784 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCS(=O)(=O)CC2C)nc1 |
| InChI | InChI=1S/C11H16N4O2S/c1-8-7-18(16,17)5-4-15(8)10-3-2-9(6-14-10)11(12)13/h2-3,6,8H,4-5,7H2,1H3,(H3,12,13) |
| InChIKey | QABIRBQVMUCTPY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|