About 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide
6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide (PubChem CID 51704360) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide |
| PubChem CID | 51704360 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2C[C@@H](C)OC[C@H]2C)nc1 |
| InChI | InChI=1S/C12H18N4O/c1-8-7-17-9(2)6-16(8)11-4-3-10(5-15-11)12(13)14/h3-5,8-9H,6-7H2,1-2H3,(H3,13,14)/t8-,9-/m1/s1 |
| InChIKey | NCNAAYVRRQGQAT-RKDXNWHRSA-N |
| XLogP | 0.98 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide?
The IUPAC name of 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide (CID 51704360) is 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide.
What is the SMILES notation for 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide?
The canonical SMILES for 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide is [H]/N=C(\N)c1ccc(N2C[C@@H](C)OC[C@H]2C)nc1.
What is the InChIKey of 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide?
The InChIKey is NCNAAYVRRQGQAT-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H18N4O/c1-8-7-17-9(2)6-16(8)11-4-3-10(5-15-11)12(13)14/h3-5,8-9H,6-7H2,1-2H3,(H3,13,14)/t8-,9-/m1/s1.
What are the key properties of 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide?
6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide has a molecular weight of 234.30 g/mol, XLogP of 0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2R,5R)-2,5-dimethylmorpholin-4-yl]pyridine-3-carboximidamide is sourced from PubChem (CID 51704360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).