C14H23N3O — CID 80634198
1-[6-(2,5-dimethylmorpholin-4-yl)-3-pyridinyl]propan-2-amine (PubChem CID 80634198) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[6-(2,5-dimethylmorpholin-4-yl)-3-pyridinyl]propan-2-amine.
| Compound Name | 1-[6-(2,5-dimethylmorpholin-4-yl)-3-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 80634198 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-[6-(2,5-dimethylmorpholin-4-yl)-3-pyridinyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(N2CC(C)OCC2C)nc1 |
| InChI | InChI=1S/C14H23N3O/c1-10(15)6-13-4-5-14(16-7-13)17-8-12(3)18-9-11(17)2/h4-5,7,10-12H,6,8-9,15H2,1-3H3 |
| InChIKey | AMSQIDZFQXOPER-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |