C14H23N3O2S — CID 102884906
N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 102884906) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102884906 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[[6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(N2CCS(=O)(=O)CC2C)nc1 |
| InChI | InChI=1S/C14H23N3O2S/c1-3-6-15-9-13-4-5-14(16-10-13)17-7-8-20(18,19)11-12(17)2/h4-5,10,12,15H,3,6-9,11H2,1-2H3 |
| InChIKey | CLUFYJCALLDWJA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|