C11H14N2O3S — CID 102884285
6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carbaldehyde (PubChem CID 102884285) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carbaldehyde.
| Compound Name | 6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 102884285 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carbaldehyde |
| SMILES | CC1CS(=O)(=O)CCN1c1ccc(C=O)cn1 |
| InChI | InChI=1S/C11H14N2O3S/c1-9-8-17(15,16)5-4-13(9)11-3-2-10(7-14)6-12-11/h2-3,6-7,9H,4-5,8H2,1H3 |
| InChIKey | BPUXQLKMOWOJNK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|