C12H15N3O4S — CID 102884957
(E)-3-[2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 102884957) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is (E)-3-[2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102884957 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (E)-3-[2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | CC1CS(=O)(=O)CCN1c1ncc(/C=C/C(=O)O)cn1 |
| InChI | InChI=1S/C12H15N3O4S/c1-9-8-20(18,19)5-4-15(9)12-13-6-10(7-14-12)2-3-11(16)17/h2-3,6-7,9H,4-5,8H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | UPGXJOGQROSZSV-NSCUHMNNSA-N |
| XLogP | 0.20 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|