C14H16ClNO4S — CID 102884967
(E)-3-[5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]prop-2-enoic acid (PubChem CID 102884967) has the molecular formula C14H16ClNO4S and a molecular weight of 329.81 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102884967 |
| Molecular Formula | C14H16ClNO4S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (E)-3-[5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]prop-2-enoic acid |
| SMILES | CC1CS(=O)(=O)CCN1c1ccc(Cl)cc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H16ClNO4S/c1-10-9-21(19,20)7-6-16(10)13-4-3-12(15)8-11(13)2-5-14(17)18/h2-5,8,10H,6-7,9H2,1H3,(H,17,18)/b5-2+ |
| InChIKey | VWXQHIPEXFCHSQ-GORDUTHDSA-N |
| XLogP | 2.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|