C12H15ClN2O2S2 — CID 102883514
5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzenecarbothioamide (PubChem CID 102883514) has the molecular formula C12H15ClN2O2S2 and a molecular weight of 318.85 g/mol. Its IUPAC name is 5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzenecarbothioamide.
| Compound Name | 5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 102883514 |
| Molecular Formula | C12H15ClN2O2S2 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 5-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzenecarbothioamide |
| SMILES | CC1CS(=O)(=O)CCN1c1ccc(Cl)cc1C(N)=S |
| InChI | InChI=1S/C12H15ClN2O2S2/c1-8-7-19(16,17)5-4-15(8)11-3-2-9(13)6-10(11)12(14)18/h2-3,6,8H,4-5,7H2,1H3,(H2,14,18) |
| InChIKey | JHKROPVYVTVKIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|