C11H14F2N2O2S — CID 102882483
2,4-difluoro-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline (PubChem CID 102882483) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is 2,4-difluoro-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline.
| Compound Name | 2,4-difluoro-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline |
|---|---|
| PubChem CID | 102882483 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2,4-difluoro-6-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)aniline |
| SMILES | CC1CS(=O)(=O)CCN1c1cc(F)cc(F)c1N |
| InChI | InChI=1S/C11H14F2N2O2S/c1-7-6-18(16,17)3-2-15(7)10-5-8(12)4-9(13)11(10)14/h4-5,7H,2-3,6,14H2,1H3 |
| InChIKey | ZURIIKAOJCUKGM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|