C13H18FNO3S — CID 102884592
(1S)-1-[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethanol (PubChem CID 102884592) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 102884592 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (1S)-1-[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]ethanol |
| SMILES | CC1CS(=O)(=O)CCN1c1ccc([C@H](C)O)cc1F |
| InChI | InChI=1S/C13H18FNO3S/c1-9-8-19(17,18)6-5-15(9)13-4-3-11(10(2)16)7-12(13)14/h3-4,7,9-10,16H,5-6,8H2,1-2H3/t9?,10-/m0/s1 |
| InChIKey | RFTKTBPKGZPRFI-AXDSSHIGSA-N |
| XLogP | 1.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|