C12H14FNO4S — CID 102884312
5-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid (PubChem CID 102884312) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid.
| Compound Name | 5-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid |
|---|---|
| PubChem CID | 102884312 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-fluoro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)benzoic acid |
| SMILES | CC1CS(=O)(=O)CCN1c1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C12H14FNO4S/c1-8-7-19(17,18)5-4-14(8)11-3-2-9(13)6-10(11)12(15)16/h2-3,6,8H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | SWGNOVSXWXQDOU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |