C12H15BrFNO2S — CID 107085438
4-[2-(bromomethyl)-4-fluorophenyl]-3-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 107085438) has the molecular formula C12H15BrFNO2S and a molecular weight of 336.23 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-4-fluorophenyl]-3-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[2-(bromomethyl)-4-fluorophenyl]-3-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 107085438 |
| Molecular Formula | C12H15BrFNO2S |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 4-[2-(bromomethyl)-4-fluorophenyl]-3-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CS(=O)(=O)CCN1c1ccc(F)cc1CBr |
| InChI | InChI=1S/C12H15BrFNO2S/c1-9-8-18(16,17)5-4-15(9)12-3-2-11(14)6-10(12)7-13/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | RNSBDBNGGLFOIE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|