C15H23FN2O2S — CID 102884919
N-[[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-2-amine (PubChem CID 102884919) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 102884919 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[[3-fluoro-4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(N2CCS(=O)(=O)CC2C)c(F)c1 |
| InChI | InChI=1S/C15H23FN2O2S/c1-11(2)17-9-13-4-5-15(14(16)8-13)18-6-7-21(19,20)10-12(18)3/h4-5,8,11-12,17H,6-7,9-10H2,1-3H3 |
| InChIKey | RPPSADBGTOWQMZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|