C11H13ClN2O4S — CID 102883883
6-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboxylic acid (PubChem CID 102883883) has the molecular formula C11H13ClN2O4S and a molecular weight of 304.75 g/mol. Its IUPAC name is 6-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 102883883 |
| Molecular Formula | C11H13ClN2O4S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 6-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)pyridine-3-carboxylic acid |
| SMILES | CC1CS(=O)(=O)CCN1c1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C11H13ClN2O4S/c1-7-6-19(17,18)5-4-14(7)10-8(11(15)16)2-3-9(12)13-10/h2-3,7H,4-6H2,1H3,(H,15,16) |
| InChIKey | PSLRLOQAOAQMGC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|