C11H13ClN2O3 — CID 55185257
6-chloro-2-(3-methylmorpholin-4-yl)pyridine-3-carboxylic acid (PubChem CID 55185257) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is 6-chloro-2-(3-methylmorpholin-4-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(3-methylmorpholin-4-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 55185257 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 6-chloro-2-(3-methylmorpholin-4-yl)pyridine-3-carboxylic acid |
| SMILES | CC1COCCN1c1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C11H13ClN2O3/c1-7-6-17-5-4-14(7)10-8(11(15)16)2-3-9(12)13-10/h2-3,7H,4-6H2,1H3,(H,15,16) |
| InChIKey | WZBLKENQNJCEPU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|