C12H15ClN2O3 — CID 63376481
6-chloro-2-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid (PubChem CID 63376481) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 6-chloro-2-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63376481 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 6-chloro-2-(2,6-dimethylmorpholin-4-yl)pyridine-3-carboxylic acid |
| SMILES | CC1CN(c2nc(Cl)ccc2C(=O)O)CC(C)O1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-7-5-15(6-8(2)18-7)11-9(12(16)17)3-4-10(13)14-11/h3-4,7-8H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | FAUWSUVDRCVTDE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|