C11H14ClFN2O — CID 170774991
(2S,6R)-4-(6-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylmorpholine (PubChem CID 170774991) has the molecular formula C11H14ClFN2O and a molecular weight of 244.70 g/mol. Its IUPAC name is (2S,6R)-4-(6-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(6-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 170774991 |
| Molecular Formula | C11H14ClFN2O |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (2S,6R)-4-(6-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(c2nc(Cl)ccc2F)C[C@H](C)O1 |
| InChI | InChI=1S/C11H14ClFN2O/c1-7-5-15(6-8(2)16-7)11-9(13)3-4-10(12)14-11/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | ATIOJBNSUBCFJE-OCAPTIKFSA-N |
| XLogP | 2.49 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|