C12H16Cl2N2O — CID 55127533
4-[(3,6-dichloro-2-pyridinyl)methyl]-2,6-dimethylmorpholine (PubChem CID 55127533) has the molecular formula C12H16Cl2N2O and a molecular weight of 275.18 g/mol. Its IUPAC name is 4-[(3,6-dichloro-2-pyridinyl)methyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[(3,6-dichloro-2-pyridinyl)methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 55127533 |
| Molecular Formula | C12H16Cl2N2O |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-[(3,6-dichloro-2-pyridinyl)methyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(Cc2nc(Cl)ccc2Cl)CC(C)O1 |
| InChI | InChI=1S/C12H16Cl2N2O/c1-8-5-16(6-9(2)17-8)7-11-10(13)3-4-12(14)15-11/h3-4,8-9H,5-7H2,1-2H3 |
| InChIKey | NZQMKKKKRXMLMY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|