C12H17ClN2O — CID 103936707
(2S,6R)-4-[(2-chloro-4-pyridinyl)methyl]-2,6-dimethylmorpholine (PubChem CID 103936707) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is (2S,6R)-4-[(2-chloro-4-pyridinyl)methyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[(2-chloro-4-pyridinyl)methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 103936707 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2S,6R)-4-[(2-chloro-4-pyridinyl)methyl]-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(Cc2ccnc(Cl)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H17ClN2O/c1-9-6-15(7-10(2)16-9)8-11-3-4-14-12(13)5-11/h3-5,9-10H,6-8H2,1-2H3/t9-,10+ |
| InChIKey | VRYRBXWZQRSPNX-AOOOYVTPSA-N |
| XLogP | 2.34 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|