C10H13Cl2N3 — CID 94889758
(3R)-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidin-3-amine (PubChem CID 94889758) has the molecular formula C10H13Cl2N3 and a molecular weight of 246.14 g/mol. Its IUPAC name is (3R)-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 94889758 |
| Molecular Formula | C10H13Cl2N3 |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (3R)-1-[(3,6-dichloro-2-pyridinyl)methyl]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(Cc2nc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C10H13Cl2N3/c11-8-1-2-10(12)14-9(8)6-15-4-3-7(13)5-15/h1-2,7H,3-6,13H2/t7-/m1/s1 |
| InChIKey | XVQWKJUYPUMRIQ-SSDOTTSWSA-N |
| XLogP | 1.92 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|