C10H11Cl3N2O2S — CID 102885437
3-methyl-4-(3,5,6-trichloro-2-pyridinyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 102885437) has the molecular formula C10H11Cl3N2O2S and a molecular weight of 329.64 g/mol. Its IUPAC name is 3-methyl-4-(3,5,6-trichloro-2-pyridinyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 3-methyl-4-(3,5,6-trichloro-2-pyridinyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 102885437 |
| Molecular Formula | C10H11Cl3N2O2S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 3-methyl-4-(3,5,6-trichloro-2-pyridinyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CS(=O)(=O)CCN1c1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl3N2O2S/c1-6-5-18(16,17)3-2-15(6)10-8(12)4-7(11)9(13)14-10/h4,6H,2-3,5H2,1H3 |
| InChIKey | SSBOHBKARFDGAE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|