C9H11ClN2O3S2 — CID 102884277
4-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 102884277) has the molecular formula C9H11ClN2O3S2 and a molecular weight of 294.79 g/mol. Its IUPAC name is 4-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 102884277 |
| Molecular Formula | C9H11ClN2O3S2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 4-chloro-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC1CS(=O)(=O)CCN1c1nc(Cl)c(C=O)s1 |
| InChI | InChI=1S/C9H11ClN2O3S2/c1-6-5-17(14,15)3-2-12(6)9-11-8(10)7(4-13)16-9/h4,6H,2-3,5H2,1H3 |
| InChIKey | SQYCCJGKQHIWRI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|