C13H20N2O3S2 — CID 102887116
4-butan-2-yl-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 102887116) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-butan-2-yl-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-butan-2-yl-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 102887116 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-butan-2-yl-2-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCC(C)c1nc(N2CCS(=O)(=O)CC2C)sc1C=O |
| InChI | InChI=1S/C13H20N2O3S2/c1-4-9(2)12-11(7-16)19-13(14-12)15-5-6-20(17,18)8-10(15)3/h7,9-10H,4-6,8H2,1-3H3 |
| InChIKey | VIDVFKOALGVNSZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|