C13H20N2OS2 — CID 114238461
2-(4-methylsulfanylpiperidin-1-yl)-4-propan-2-yl-1,3-thiazole-5-carbaldehyde (PubChem CID 114238461) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-(4-methylsulfanylpiperidin-1-yl)-4-propan-2-yl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4-methylsulfanylpiperidin-1-yl)-4-propan-2-yl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 114238461 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-(4-methylsulfanylpiperidin-1-yl)-4-propan-2-yl-1,3-thiazole-5-carbaldehyde |
| SMILES | CSC1CCN(c2nc(C(C)C)c(C=O)s2)CC1 |
| InChI | InChI=1S/C13H20N2OS2/c1-9(2)12-11(8-16)18-13(14-12)15-6-4-10(17-3)5-7-15/h8-10H,4-7H2,1-3H3 |
| InChIKey | KLVGSLXWKYJPTE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|