C16H26N2OS — CID 63514260
2-(4-tert-butylpiperidin-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde (PubChem CID 63514260) has the molecular formula C16H26N2OS and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-(4-tert-butylpiperidin-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(4-tert-butylpiperidin-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63514260 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-(4-tert-butylpiperidin-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCc1nc(N2CCC(C(C)(C)C)CC2)sc1C=O |
| InChI | InChI=1S/C16H26N2OS/c1-5-6-13-14(11-19)20-15(17-13)18-9-7-12(8-10-18)16(2,3)4/h11-12H,5-10H2,1-4H3 |
| InChIKey | VWKKDJBHPBZDLX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|