C14H22N2OS — CID 62766450
2-(azocan-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde (PubChem CID 62766450) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-(azocan-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(azocan-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62766450 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-(azocan-1-yl)-4-propyl-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCc1nc(N2CCCCCCC2)sc1C=O |
| InChI | InChI=1S/C14H22N2OS/c1-2-8-12-13(11-17)18-14(15-12)16-9-6-4-3-5-7-10-16/h11H,2-10H2,1H3 |
| InChIKey | VLUSJWFYBAQVSK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|