C14H23N3OS — CID 81469738
2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-4-propyl-1,3-thiazole-5-carbaldehyde (PubChem CID 81469738) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-4-propyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-4-propyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 81469738 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-4-propyl-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCc1nc(N2CC(C)C(N(C)C)C2)sc1C=O |
| InChI | InChI=1S/C14H23N3OS/c1-5-6-11-13(9-18)19-14(15-11)17-7-10(2)12(8-17)16(3)4/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | KOGVXRKISQMIMY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|