C11H17Cl2N3S — CID 81474880
1-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 81474880) has the molecular formula C11H17Cl2N3S and a molecular weight of 294.25 g/mol. Its IUPAC name is 1-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | 1-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81474880 |
| Molecular Formula | C11H17Cl2N3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | CC1CN(c2nc(Cl)c(CCl)s2)CC1N(C)C |
| InChI | InChI=1S/C11H17Cl2N3S/c1-7-5-16(6-8(7)15(2)3)11-14-10(13)9(4-12)17-11/h7-8H,4-6H2,1-3H3 |
| InChIKey | MGLHBVLNDRACGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|