C9H12Cl2N2OS — CID 80688129
4-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-2-methylmorpholine (PubChem CID 80688129) has the molecular formula C9H12Cl2N2OS and a molecular weight of 267.18 g/mol. Its IUPAC name is 4-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-2-methylmorpholine.
| Compound Name | 4-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-2-methylmorpholine |
|---|---|
| PubChem CID | 80688129 |
| Molecular Formula | C9H12Cl2N2OS |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 4-[4-chloro-5-(chloromethyl)-1,3-thiazol-2-yl]-2-methylmorpholine |
| SMILES | CC1CN(c2nc(Cl)c(CCl)s2)CCO1 |
| InChI | InChI=1S/C9H12Cl2N2OS/c1-6-5-13(2-3-14-6)9-12-8(11)7(4-10)15-9/h6H,2-5H2,1H3 |
| InChIKey | QEQIDUKEQFQIRS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|