C11H17Cl2N3S — CID 80688419
4-chloro-5-(chloromethyl)-2-(3,3,4-trimethylpiperazin-1-yl)-1,3-thiazole (PubChem CID 80688419) has the molecular formula C11H17Cl2N3S and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-(3,3,4-trimethylpiperazin-1-yl)-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-(3,3,4-trimethylpiperazin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 80688419 |
| Molecular Formula | C11H17Cl2N3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-(3,3,4-trimethylpiperazin-1-yl)-1,3-thiazole |
| SMILES | CN1CCN(c2nc(Cl)c(CCl)s2)CC1(C)C |
| InChI | InChI=1S/C11H17Cl2N3S/c1-11(2)7-16(5-4-15(11)3)10-14-9(13)8(6-12)17-10/h4-7H2,1-3H3 |
| InChIKey | PHLWOYNUGOCXJS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|