C11H12Cl2N4S2 — CID 80687206
4-chloro-5-(chloromethyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole (PubChem CID 80687206) has the molecular formula C11H12Cl2N4S2 and a molecular weight of 335.29 g/mol. Its IUPAC name is 4-chloro-5-(chloromethyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 4-chloro-5-(chloromethyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 80687206 |
| Molecular Formula | C11H12Cl2N4S2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 4-chloro-5-(chloromethyl)-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole |
| SMILES | ClCc1sc(N2CCN(c3nccs3)CC2)nc1Cl |
| InChI | InChI=1S/C11H12Cl2N4S2/c12-7-8-9(13)15-11(19-8)17-4-2-16(3-5-17)10-14-1-6-18-10/h1,6H,2-5,7H2 |
| InChIKey | MXZPWQRNGLCUIM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|