C12H14ClN5S — CID 61256786
2-[4-[6-(chloromethyl)pyridazin-3-yl]piperazin-1-yl]-1,3-thiazole (PubChem CID 61256786) has the molecular formula C12H14ClN5S and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-[4-[6-(chloromethyl)pyridazin-3-yl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[6-(chloromethyl)pyridazin-3-yl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 61256786 |
| Molecular Formula | C12H14ClN5S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[4-[6-(chloromethyl)pyridazin-3-yl]piperazin-1-yl]-1,3-thiazole |
| SMILES | ClCc1ccc(N2CCN(c3nccs3)CC2)nn1 |
| InChI | InChI=1S/C12H14ClN5S/c13-9-10-1-2-11(16-15-10)17-4-6-18(7-5-17)12-14-3-8-19-12/h1-3,8H,4-7,9H2 |
| InChIKey | JNTDKRPIIMUXSW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|