C13H15ClN4S — CID 105067252
2-[4-[4-(chloromethyl)-3-pyridinyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 105067252) has the molecular formula C13H15ClN4S and a molecular weight of 294.81 g/mol. Its IUPAC name is 2-[4-[4-(chloromethyl)-3-pyridinyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[4-(chloromethyl)-3-pyridinyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 105067252 |
| Molecular Formula | C13H15ClN4S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[4-[4-(chloromethyl)-3-pyridinyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | ClCc1ccncc1N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C13H15ClN4S/c14-9-11-1-2-15-10-12(11)17-4-6-18(7-5-17)13-16-3-8-19-13/h1-3,8,10H,4-7,9H2 |
| InChIKey | QWETZNQMSDKYNY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|