C14H15BrClN3S — CID 107079219
2-[4-[2-(bromomethyl)-5-chlorophenyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 107079219) has the molecular formula C14H15BrClN3S and a molecular weight of 372.72 g/mol. Its IUPAC name is 2-[4-[2-(bromomethyl)-5-chlorophenyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[2-(bromomethyl)-5-chlorophenyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 107079219 |
| Molecular Formula | C14H15BrClN3S |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2-[4-[2-(bromomethyl)-5-chlorophenyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | Clc1ccc(CBr)c(N2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C14H15BrClN3S/c15-10-11-1-2-12(16)9-13(11)18-4-6-19(7-5-18)14-17-3-8-20-14/h1-3,8-9H,4-7,10H2 |
| InChIKey | QHPBQOGJTPNCCP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|