About (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine
(1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine (PubChem CID 63368236) has the molecular formula C15H19ClN4S
and a molecular weight of 322.87 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine |
| PubChem CID | 63368236 |
| Molecular Formula | C15H19ClN4S |
| Molecular Weight | 322.87 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(N2CCN(c3nccs3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H19ClN4S/c1-11(17)12-2-3-14(13(16)10-12)19-5-7-20(8-6-19)15-18-4-9-21-15/h2-4,9-11H,5-8,17H2,1H3/t11-/m1/s1 |
| InChIKey | MWHRSPDPFAICMQ-LLVKDONJSA-N |
| XLogP | 3.14 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.87 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine?
The IUPAC name of (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine (CID 63368236) is (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine.
What is the SMILES notation for (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine?
The canonical SMILES for (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine is C[C@@H](N)c1ccc(N2CCN(c3nccs3)CC2)c(Cl)c1.
What is the InChIKey of (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine?
The InChIKey is MWHRSPDPFAICMQ-LLVKDONJSA-N. The full InChI is InChI=1S/C15H19ClN4S/c1-11(17)12-2-3-14(13(16)10-12)19-5-7-20(8-6-19)15-18-4-9-21-15/h2-4,9-11H,5-8,17H2,1H3/t11-/m1/s1.
What are the key properties of (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine?
(1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine has a molecular weight of 322.87 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[3-chloro-4-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanamine is sourced from PubChem (CID 63368236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).