C17H27ClN2 — CID 78944491
(1S)-1-[3-chloro-4-(4,4-diethylpiperidin-1-yl)phenyl]ethanamine (PubChem CID 78944491) has the molecular formula C17H27ClN2 and a molecular weight of 294.87 g/mol. Its IUPAC name is (1S)-1-[3-chloro-4-(4,4-diethylpiperidin-1-yl)phenyl]ethanamine.
| Compound Name | (1S)-1-[3-chloro-4-(4,4-diethylpiperidin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 78944491 |
| Molecular Formula | C17H27ClN2 |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (1S)-1-[3-chloro-4-(4,4-diethylpiperidin-1-yl)phenyl]ethanamine |
| SMILES | CCC1(CC)CCN(c2ccc([C@H](C)N)cc2Cl)CC1 |
| InChI | InChI=1S/C17H27ClN2/c1-4-17(5-2)8-10-20(11-9-17)16-7-6-14(13(3)19)12-15(16)18/h6-7,12-13H,4-5,8-11,19H2,1-3H3/t13-/m0/s1 |
| InChIKey | ORBFXCOKQFMZNZ-ZDUSSCGKSA-N |
| XLogP | 4.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |