C14H21ClN2 — CID 79188821
1-[3-chloro-4-(3,4-dimethylpyrrolidin-1-yl)phenyl]ethanamine (PubChem CID 79188821) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-[3-chloro-4-(3,4-dimethylpyrrolidin-1-yl)phenyl]ethanamine.
| Compound Name | 1-[3-chloro-4-(3,4-dimethylpyrrolidin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 79188821 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-[3-chloro-4-(3,4-dimethylpyrrolidin-1-yl)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(N2CC(C)C(C)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2/c1-9-7-17(8-10(9)2)14-5-4-12(11(3)16)6-13(14)15/h4-6,9-11H,7-8,16H2,1-3H3 |
| InChIKey | BJMGCCGJSRRICV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |