C14H21ClN2 — CID 78935727
(1R)-1-[3-chloro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine (PubChem CID 78935727) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-chloro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 78935727 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (1R)-1-[3-chloro-4-(3-methylpiperidin-1-yl)phenyl]ethanamine |
| SMILES | CC1CCCN(c2ccc([C@@H](C)N)cc2Cl)C1 |
| InChI | InChI=1S/C14H21ClN2/c1-10-4-3-7-17(9-10)14-6-5-12(11(2)16)8-13(14)15/h5-6,8,10-11H,3-4,7,9,16H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | UJXVWWBICGDKGY-RRKGBCIJSA-N |
| XLogP | 3.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |