C9H16N2S — CID 176952882
ethane;2-pyrrolidin-1-yl-1,3-thiazole (PubChem CID 176952882) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is ethane;2-pyrrolidin-1-yl-1,3-thiazole.
| Compound Name | ethane;2-pyrrolidin-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 176952882 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | ethane;2-pyrrolidin-1-yl-1,3-thiazole |
| SMILES | CC.c1csc(N2CCCC2)n1 |
| InChI | InChI=1S/C7H10N2S.C2H6/c1-2-5-9(4-1)7-8-3-6-10-7;1-2/h3,6H,1-2,4-5H2;1-2H3 |
| InChIKey | XPWOKWUUGZYHBI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |