C12H17N3S — CID 136573614
2-[4-(2-methylbut-3-yn-2-yl)piperazin-1-yl]-1,3-thiazole (PubChem CID 136573614) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is 2-[4-(2-methylbut-3-yn-2-yl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-(2-methylbut-3-yn-2-yl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 136573614 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[4-(2-methylbut-3-yn-2-yl)piperazin-1-yl]-1,3-thiazole |
| SMILES | C#CC(C)(C)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C12H17N3S/c1-4-12(2,3)15-8-6-14(7-9-15)11-13-5-10-16-11/h1,5,10H,6-9H2,2-3H3 |
| InChIKey | LWFUXTMCPZGGEP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|