C15H28N4S — CID 62263028
2,2-dimethyl-N-propyl-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-amine (PubChem CID 62263028) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is 2,2-dimethyl-N-propyl-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-amine.
| Compound Name | 2,2-dimethyl-N-propyl-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 62263028 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2,2-dimethyl-N-propyl-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-1-amine |
| SMILES | CCCNCC(C)(C)CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H28N4S/c1-4-5-16-12-15(2,3)13-18-7-9-19(10-8-18)14-17-6-11-20-14/h6,11,16H,4-5,7-10,12-13H2,1-3H3 |
| InChIKey | SQAMIBONJKUGEW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|