C14H26N4S — CID 62558685
N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propyl]butan-1-amine (PubChem CID 62558685) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propyl]butan-1-amine.
| Compound Name | N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propyl]butan-1-amine |
|---|---|
| PubChem CID | 62558685 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propyl]butan-1-amine |
| SMILES | CCCCNCC(C)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C14H26N4S/c1-3-4-5-15-12-13(2)17-7-9-18(10-8-17)14-16-6-11-19-14/h6,11,13,15H,3-5,7-10,12H2,1-2H3 |
| InChIKey | LVMRGXMWONSGRR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|