C12H21N3O2S2 — CID 90597476
N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butane-1-sulfonamide (PubChem CID 90597476) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butane-1-sulfonamide.
| Compound Name | N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 90597476 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-2-3-10-19(16,17)14-11-4-7-15(8-5-11)12-13-6-9-18-12/h6,9,11,14H,2-5,7-8,10H2,1H3 |
| InChIKey | BJLOVEKVSQFLMD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |