C16H21N3O3S2 — CID 90597556
2-phenoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethanesulfonamide (PubChem CID 90597556) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-phenoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethanesulfonamide.
| Compound Name | 2-phenoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 90597556 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-phenoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]ethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccccc1)NC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H21N3O3S2/c20-24(21,13-11-22-15-4-2-1-3-5-15)18-14-6-9-19(10-7-14)16-17-8-12-23-16/h1-5,8,12,14,18H,6-7,9-11,13H2 |
| InChIKey | KNMMEQYDBJKXOG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |